AC46874
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $23.00 | $16.00 | - + | |
10mg | 95% | in stock | $63.00 | $44.00 | - + | |
25mg | 95% | in stock | $76.00 | $53.00 | - + | |
50mg | 95% | in stock | $92.00 | $64.00 | - + | |
250mg | 95% | in stock | $433.00 | $303.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC46874 |
Chemical Name: | D-64131 |
CAS Number: | 74588-78-6 |
Molecular Formula: | C16H13NO2 |
Molecular Weight: | 251.2799 |
MDL Number: | MFCD04039791 |
SMILES: | COc1ccc2c(c1)cc([nH]2)C(=O)c1ccccc1 |
Complexity: | 325 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.7 |
Journal of medicinal chemistry 20091008
Cancer research 20020601
Journal of medicinal chemistry 20011220