logo
Home  > (S)-2,5-Dihydro-pyrrole-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester

AH50083

74844-93-2 | (S)-2,5-Dihydro-pyrrole-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester

Packsize Purity Availability Price Discounted Price    Quantity
100mg 96% in stock $11.00 $8.00 -   +
250mg 96% in stock $14.00 $10.00 -   +
1g 96% in stock $33.00 $24.00 -   +
5g 96% in stock $45.00 $32.00 -   +
25g 96% in stock $105.00 $74.00 -   +
100g 96% in stock $273.00 $192.00 -   +
500g 96% in stock $929.00 $650.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AH50083
Chemical Name: (S)-2,5-Dihydro-pyrrole-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester
CAS Number: 74844-93-2
Molecular Formula: C11H17NO4
Molecular Weight: 227.257
MDL Number: MFCD00080341
SMILES: COC(=O)[C@@H]1C=CCN1C(=O)OC(C)(C)C

 

Upstream Synthesis Route
  • (S)-1-tert-Butyl 2-methyl 1H-pyrrole-1,2(2H,5H)-dicarboxylate, commonly referred to as $name$, is a versatile compound used in chemical synthesis for various applications. This compound is particularly valuable in asymmetric synthesis, where it serves as a key chiral building block for the preparation of enantiomerically pure compounds.One of the notable applications of (S)-1-tert-Butyl 2-methyl 1H-pyrrole-1,2(2H,5H)-dicarboxylate is in the synthesis of pharmaceuticals and agrochemicals. Its unique chiral structure allows for the creation of molecules with specific stereochemistry, which is crucial for enhancing the biological activity and efficacy of these products. By incorporating this compound into synthetic routes, chemists can access a wide range of enantiomerically pure compounds that exhibit desired pharmacological properties.Furthermore, (S)-1-tert-Butyl 2-methyl 1H-pyrrole-1,2(2H,5H)-dicarboxylate plays a significant role in the development of new materials and catalysts. Its chiral nature enables the synthesis of advanced materials with tailored properties, such as optoelectronic materials, liquid crystals, and polymers. Additionally, this compound can be utilized in the preparation of chiral ligands for asymmetric catalysis, facilitating the production of complex molecules with high selectivity and efficiency.In summary, (S)-1-tert-Butyl 2-methyl 1H-pyrrole-1,2(2H,5H)-dicarboxylate is a valuable tool in chemical synthesis, offering opportunities for the creation of enantiomerically pure compounds with diverse applications in pharmaceuticals, agrochemicals, materials science, and catalysis.
FEATURED PRODUCTS