AI55971
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 98% | in stock | $7.00 | $5.00 | - + | |
100g | 98% | in stock | $31.00 | $22.00 | - + | |
500g | 98% | in stock | $151.00 | $106.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI55971 |
Chemical Name: | Boc-(s)-2-aminosuccinic acid 4-amide monohydrate |
CAS Number: | 7536-55-2 |
Molecular Formula: | C9H16N2O5 |
Molecular Weight: | 232.2337 |
MDL Number: | MFCD00038152 |
SMILES: | O=C(OC(C)(C)C)N[C@H](C(=O)O)CC(=O)N |
Complexity: | 295 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
XLogP3: | -0.6 |
Nature chemical biology 20090101
Bioscience, biotechnology, and biochemistry 20060601