AB69986
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $19.00 | $13.00 | - + | |
10g | 95% | in stock | $20.00 | $14.00 | - + | |
25g | 95% | in stock | $24.00 | $17.00 | - + | |
100g | 95% | in stock | $89.00 | $62.00 | - + | |
250g | 95% | in stock | $161.00 | $113.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB69986 |
Chemical Name: | 6-Nitroindazole |
CAS Number: | 7597-18-4 |
Molecular Formula: | C7H5N3O2 |
Molecular Weight: | 163.1335 |
MDL Number: | MFCD00005695 |
SMILES: | [O-][N+](=O)c1ccc2c(c1)[nH]nc2 |
Complexity: | 192 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
XLogP3: | 2.1 |
6-Nitro-1H-indazole, also known as 1H-Indazole-6-nitro, is a chemical compound commonly used in chemical synthesis processes. This versatile compound is utilized in organic synthesis for its unique reactivity and ability to undergo various reactions to produce a wide range of compounds.In chemical synthesis, 6-Nitro-1H-indazole serves as a valuable building block for the preparation of diverse heterocyclic compounds and pharmaceutical intermediates. Its nitro group (-NO2) provides a reactive site for further functionalization through reduction or substitution reactions. Additionally, the presence of the indazole ring imparts specific structural features that can be exploited in the design of molecules with desired properties.One of the prominent applications of 6-Nitro-1H-indazole is its role in the synthesis of biologically active compounds, such as pharmaceuticals, agrochemicals, and dyes. By incorporating this compound into synthetic routes, chemists can access a wide array of derivatives with potential therapeutic or industrial significance. Furthermore, the versatility of 6-Nitro-1H-indazole allows for modification at different positions of the molecule, enabling the fine-tuning of properties for specific applications.Overall, 6-Nitro-1H-indazole is a valuable tool in chemical synthesis, offering chemists the opportunity to design and construct complex molecules with precision and efficiency. Its utility extends across various fields of organic chemistry, making it a sought-after reagent for creating novel compounds with diverse functionalities.
Free radical research 20091001
Bioorganic & medicinal chemistry 20090901
The Journal of pharmacology and experimental therapeutics 20080501
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501
Biochemistry 20021126