AH55319
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $134.00 | $94.00 | - + | |
5mg | 99% | in stock | $328.00 | $230.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH55319 |
Chemical Name: | Nicainoprol |
CAS Number: | 76252-06-7 |
Molecular Formula: | C21H27N3O3 |
Molecular Weight: | 369.4574 |
MDL Number: | MFCD00865522 |
SMILES: | OC(COc1cccc2c1N(CCC2)C(=O)c1cccnc1)CNC(C)C |
Complexity: | 474 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 27 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 1.6 |
Cardiovascular drugs and therapy 19891201