AH50439
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $25.00 | $17.00 | - + | |
1g | 97% | in stock | $35.00 | $24.00 | - + | |
5g | 97% | in stock | $129.00 | $90.00 | - + | |
10g | 97% | in stock | $232.00 | $162.00 | - + | |
25g | 97% | in stock | $515.00 | $360.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH50439 |
Chemical Name: | Boc-ser-otbu |
CAS Number: | 7738-22-9 |
Molecular Formula: | C12H23NO5 |
Molecular Weight: | 261.3147 |
MDL Number: | MFCD00190832 |
SMILES: | OC[C@@H](C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
Complexity: | 301 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 1.2 |
Boc-Ser-OtBu is a key reagent employed in chemical synthesis as a means to protect the serine amino acid residue. This derivative plays a crucial role in peptide and protein synthesis by temporarily masking the reactive hydroxyl group of serine with a Boc (tert-butoxycarbonyl) group. This protection strategy is essential in ensuring the selectivity of chemical reactions, allowing for the manipulation of other functional groups without affecting the serine residue. Boc-Ser-OtBu is utilized in the generation of complex peptide structures and in the preparation of peptide-based pharmaceuticals. Its precise and controlled deprotection under specific conditions enables the targeted assembly of peptides with desired sequences and structures. In the realm of chemical synthesis, Boc-Ser-OtBu serves as a versatile tool for the efficient construction of peptide chains and the creation of diverse molecular architectures.