AE05168
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $193.00 | $135.00 | - + | |
1g | 95% | in stock | $458.00 | $320.00 | - + | |
5g | 95% | in stock | $1,387.00 | $971.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE05168 |
Chemical Name: | N-(4-Nitrophenyl)acrylamide |
CAS Number: | 7766-38-3 |
Molecular Formula: | C9H8N2O3 |
Molecular Weight: | 192.17142 |
MDL Number: | MFCD12091233 |
SMILES: | C=CC(=O)Nc1ccc(cc1)[N+](=O)[O-] |
Complexity: | 239 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.3 |
Journal of medicinal chemistry 20120209