AB61781
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 98% | in stock | $15.00 | $10.00 | - + | |
100g | 98% | in stock | $18.00 | $13.00 | - + | |
500g | 98% | in stock | $52.00 | $37.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB61781 |
Chemical Name: | 1-Chloro-4-nitro-2-(trifluoromethyl)benzene |
CAS Number: | 777-37-7 |
Molecular Formula: | C7H3ClF3NO2 |
Molecular Weight: | 225.5524 |
MDL Number: | MFCD00007296 |
SMILES: | [O-][N+](=O)c1ccc(c(c1)C(F)(F)F)Cl |
NSC Number: | 9467 |
Complexity: | 228 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
XLogP3: | 4 |
The Journal of organic chemistry 20050610