AB78683
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 96% | in stock | $8.00 | $6.00 | - + | |
10g | 96% | in stock | $11.00 | $8.00 | - + | |
25g | 96% | in stock | $14.00 | $10.00 | - + | |
100g | 96% | in stock | $43.00 | $30.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB78683 |
Chemical Name: | P-Toluenesulfonic acid n-butyl ester |
CAS Number: | 778-28-9 |
Molecular Formula: | C11H16O3S |
Molecular Weight: | 228.3079 |
MDL Number: | MFCD00027203 |
SMILES: | CCCCOS(=O)(=O)c1ccc(cc1)C |
NSC Number: | 6190 |
Complexity: | 258 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | 2.7 |
The Journal of organic chemistry 20060203