AB53449
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $59.00 | $41.00 | - + | |
5mg | 95% | in stock | $120.00 | $84.00 | - + | |
10mg | 95% | in stock | $208.00 | $145.00 | - + | |
25mg | 95% | in stock | $389.00 | $272.00 | - + | |
50mg | 95% | in stock | $619.00 | $433.00 | - + | |
100mg | 95% | in stock | $735.00 | $514.00 | - + | |
250mg | 95% | in stock | $1,318.00 | $922.00 | - + | |
1g | 95% | in stock | $5,046.00 | $3,532.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB53449 |
Chemical Name: | Dinaciclib |
CAS Number: | 779353-01-4 |
Molecular Formula: | C21H28N6O2 |
Molecular Weight: | 396.486 |
MDL Number: | MFCD16037702 |
SMILES: | OCC[C@@H]1CCCCN1c1cc(NCc2ccc[n+](c2)[O-])n2c(n1)c(CC)cn2 |
(2S)-1-[3-Ethyl-7-[[(1-oxido-3-pyridinyl)methyl]amino]pyrazolo[1,5-a]pyrimidin-5-yl]-2-piperidineethanol, or $name$, plays a crucial role in chemical synthesis as a versatile building block. This compound's unique structure allows it to serve as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and advanced materials. Its functional groups enable it to participate in diverse chemical reactions, such as acylation, alkylation, and reduction, leading to the formation of complex molecules with specific biological activities or properties. Additionally, the stereochemistry of the piperidine ring provides stereocontrol in asymmetric synthesis, facilitating the production of chiral compounds with high enantiomeric purity. By incorporating $name$ into synthetic pathways, chemists can access a wide range of structurally diverse and biologically active compounds for applications in drug discovery, material science, and chemical research.