AB70122
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 98% | in stock | $11.00 | $8.00 | - + | |
100mg | 98% | in stock | $13.00 | $9.00 | - + | |
250mg | 98% | in stock | $22.00 | $15.00 | - + | |
1g | 98% | in stock | $70.00 | $49.00 | - + | |
5g | 98% | in stock | $200.00 | $140.00 | - + | |
25g | 98% | in stock | $505.00 | $353.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB70122 |
Chemical Name: | (19S)-10,19-diethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.0^{2,11}.0^{4,9}.0^{15,20}]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
CAS Number: | 78287-27-1 |
Molecular Formula: | C22H20N2O4 |
Molecular Weight: | 376.4052 |
MDL Number: | MFCD06657922 |
SMILES: | CC[C@@]1(O)C(=O)OCc2c1cc1-c3nc4ccccc4c(c3Cn1c2=O)CC |
Complexity: | 787 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 28 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 1.8 |
Journal of medicinal chemistry 20110324
Analytica chimica acta 20070219