AC50224
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $50.00 | $35.00 | - + | |
250mg | 95% | in stock | $72.00 | $51.00 | - + | |
1g | 95% | in stock | $129.00 | $90.00 | - + | |
5g | 95% | in stock | $449.00 | $315.00 | - + | |
10g | 95% | in stock | $775.00 | $543.00 | - + | |
25g | 95% | in stock | $1,536.00 | $1,075.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC50224 |
Chemical Name: | 2'-Deoxy-2'-fluoroguanosine |
CAS Number: | 78842-13-4 |
Molecular Formula: | C10H12FN5O4 |
Molecular Weight: | 285.2318 |
MDL Number: | MFCD00923832 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)F)n1cnc2c1nc(N)[nH]c2=O |
Complexity: | 449 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | -0.9 |
Journal of medicinal chemistry 20040422
Nucleosides, nucleotides & nucleic acids 20030101
Antiviral research 19930801