AI56585
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $24.00 | $17.00 | - + | |
5g | 95% | in stock | $54.00 | $38.00 | - + | |
25g | ≥ 99% (HPLC) | in stock | $183.00 | $128.00 | - + | |
100g | ≥ 99% (HPLC) | in stock | $526.00 | $368.00 | - + | |
250g | ≥ 99% (HPLC) | in stock | $1,240.00 | $868.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI56585 |
Chemical Name: | Helicid |
CAS Number: | 80154-34-3 |
Molecular Formula: | C13H16O7 |
Molecular Weight: | 284.2619 |
MDL Number: | MFCD00210992 |
SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2)C=O)[C@@H]([C@@H]([C@@H]1O)O)O |
Complexity: | 316 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 5 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 4 |
XLogP3: | -0.9 |
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences 20100315
Bioorganic & medicinal chemistry letters 20091101
Bioorganic & medicinal chemistry 20091001
Bioorganic & medicinal chemistry letters 20081215
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences 20070301
Bioorganic & medicinal chemistry letters 20060201
Zhongguo Zhong yao za zhi = Zhongguo zhongyao zazhi = China journal of Chinese materia medica 20050601