AB74514
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $8.00 | $6.00 | - + | |
250mg | 98% | in stock | $17.00 | $12.00 | - + | |
1g | 98% | in stock | $42.00 | $30.00 | - + | |
5g | 98% | in stock | $114.00 | $80.00 | - + | |
25g | 95% | in stock | $207.00 | $145.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB74514 |
Chemical Name: | Gmbs |
CAS Number: | 80307-12-6 |
Molecular Formula: | C12H12N2O6 |
Molecular Weight: | 280.2335 |
MDL Number: | MFCD00036817 |
SMILES: | O=C(ON1C(=O)CCC1=O)CCCN1C(=O)C=CC1=O |
Complexity: | 490 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 6 |
XLogP3: | -1.2 |
Biochemistry 20080708
Journal of molecular biology 20070202
Biochemistry 20050222
Biotechnology and bioengineering 20031020