AB52357
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 96% | in stock | $12.00 | $8.00 | - + | |
5g | tech | in stock | $18.00 | $12.00 | - + | |
25g | 95% | in stock | $34.00 | $24.00 | - + | |
100g | 95% | in stock | $74.00 | $52.00 | - + | |
500g | >94.0%(T) | in stock | $245.00 | $171.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52357 |
Chemical Name: | 4,4'-Diaminostilbene-2,2'-disulfonic acid |
CAS Number: | 81-11-8 |
Molecular Formula: | C14H14N2O6S2 |
Molecular Weight: | 370.4008 |
MDL Number: | MFCD00024946 |
SMILES: | Nc1ccc(c(c1)S(=O)(=O)O)/C=C/c1ccc(cc1S(=O)(=O)O)N |
NSC Number: | 163 |
Complexity: | 606 |
Covalently-Bonded Unit Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 4 |
XLogP3: | 0.3 |
Biological chemistry 20071001
Journal of colloid and interface science 20060115
Huan jing ke xue= Huanjing kexue 20011101
Water research 20010601
Biological trace element research 20000101
Biochemistry 19990629