AE00516
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $320.00 | $224.00 | - + | |
250mg | 95% | in stock | $406.00 | $284.00 | - + | |
1g | 95% | in stock | $963.00 | $674.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE00516 |
Chemical Name: | 6-Azabicyclo[3.1.0]hexane, 6-[(4-methylphenyl)sulfonyl]- |
CAS Number: | 81097-48-5 |
Molecular Formula: | C12H15NO2S |
Molecular Weight: | 237.318 |
MDL Number: | MFCD02852961 |
SMILES: | Cc1ccc(cc1)S(=O)(=O)N1C2C1CCC2 |
Complexity: | 355 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 2 |
Undefined Atom Stereocenter Count: | 2 |
XLogP3: | 2.2 |
European journal of medicinal chemistry 20090601