AB47399
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $19.00 | $13.00 | - + | |
500mg | 95% | in stock | $26.00 | $18.00 | - + | |
1g | 95% | in stock | $43.00 | $30.00 | - + | |
5g | 95% | in stock | $165.00 | $115.00 | - + | |
10g | 95% | in stock | $328.00 | $229.00 | - + | |
25g | 95% | in stock | $818.00 | $572.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB47399 |
Chemical Name: | tert-Butyl (14-amino-3,6,9,12-tetraoxatetradecyl)carbamate |
CAS Number: | 811442-84-9 |
Molecular Formula: | C15H32N2O6 |
Molecular Weight: | 336.42438 |
MDL Number: | MFCD16619339 |
SMILES: | NCCOCCOCCOCCOCCNC(=O)OC(C)(C)C |
Complexity: | 284 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 16 |
XLogP3: | -0.6 |
5,8,11,14-Tetraoxa-2-azahexadecanoic acid, 16-amino-, 1,1-dimethylethyl ester is a versatile compound widely used in chemical synthesis processes. This compound serves as a key building block in the development of novel materials and compounds for various applications. Its unique structure and properties make it a valuable component in the creation of specialized polymers, pharmaceuticals, and advanced materials. In chemical synthesis, this compound is utilized as a linker or spacer molecule to connect different functional groups or molecular entities. Its ability to form stable bonds and provide flexibility in molecular design makes it an essential tool for designing complex chemical structures with specific properties and functions.