AB52757
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $65.00 | $45.00 | - + | |
5g | 97% | in stock | $283.00 | $198.00 | - + | |
10g | 97% | in stock | $510.00 | $357.00 | - + | |
25g | 97% | in stock | $1,007.00 | $705.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52757 |
Chemical Name: | 5'-Dmt-3'-tbdms-bz-ra |
CAS Number: | 81256-88-4 |
Molecular Formula: | C44H49N5O7Si |
Molecular Weight: | 787.9747 |
MDL Number: | MFCD00274103 |
SMILES: | COc1ccc(cc1)C(c1ccc(cc1)OC)(c1ccccc1)OC[C@H]1O[C@H]([C@@H]([C@@H]1O[Si](C(C)(C)C)(C)C)O)n1cnc2c1ncnc2NC(=O)c1ccccc1 |
Complexity: | 1250 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 57 |
Hydrogen Bond Acceptor Count: | 10 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 14 |
N-Benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-3'-O-[(1,1-dimethylethyl)dimethylsilyl]adenosine is a versatile compound widely used in chemical synthesis as a protecting group strategy. This compound serves as an effective protective agent to shield specific functional groups during various synthetic reactions, preventing undesired side reactions and enhancing selectivity. By utilizing N-Benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-3'-O-[(1,1-dimethylethyl)dimethylsilyl]adenosine as a protecting group, chemists can manipulate and control the reactivity of different functional groups within a molecule, facilitating complex organic synthesis processes. Its application allows for precise modification of molecules, enabling the synthesis of intricate structures with high efficiency and purity.