AB44819
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $8.00 | $5.00 | - + | |
250mg | 95% | in stock | $9.00 | $6.00 | - + | |
1g | 95% | in stock | $17.00 | $12.00 | - + | |
5g | 95% | in stock | $59.00 | $41.00 | - + | |
10g | 95% | in stock | $98.00 | $68.00 | - + | |
25g | 95% | in stock | $190.00 | $133.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB44819 |
Chemical Name: | 4-Amino-3-fluorophenylboronic acid pinacol ester |
CAS Number: | 819058-34-9 |
Molecular Formula: | C12H17BFNO2 |
Molecular Weight: | 237.0783 |
MDL Number: | MFCD09033884 |
SMILES: | Nc1ccc(cc1F)B1OC(C(O1)(C)C)(C)C |
Complexity: | 282 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
4-Amino-3-fluorophenylboronic acid, pinacol ester is a key reagent commonly employed in chemical synthesis for various applications. This compound serves as a valuable building block in advanced organic chemistry, particularly in the field of medicinal chemistry and drug development. Its unique structure and reactivity make it a versatile tool for the synthesis of complex molecules with high precision and efficiency.One of the main applications of 4-Amino-3-fluorophenylboronic acid, pinacol ester is in Suzuki-Miyaura cross-coupling reactions. This reaction is widely used in the formation of carbon-carbon bonds, allowing for the rapid and efficient construction of biaryl compounds. By utilizing this boronic acid derivative as a coupling partner, chemists can access a diverse range of functionalized biaryl motifs, which are prevalent in many pharmaceuticals and agrochemicals.Furthermore, 4-Amino-3-fluorophenylboronic acid, pinacol ester can also be used in transition metal-catalyzed C-H activation reactions. In this context, the boronic acid moiety acts as a directing group, enabling the selective functionalization of specific C-H bonds within a molecule. This strategy facilitates the late-stage modification of complex molecules and streamlines the synthesis of valuable intermediates for further elaboration.Overall, the strategic incorporation of 4-Amino-3-fluorophenylboronic acid, pinacol ester in chemical synthesis enables chemists to access diverse structural motifs and accelerate the development of novel compounds with potential biological activity.