AE00568
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $25.00 | $18.00 | - + | |
1g | 95% | in stock | $49.00 | $34.00 | - + | |
5g | 95% | in stock | $105.00 | $74.00 | - + | |
25g | 95% | in stock | $297.00 | $208.00 | - + | |
100g | 95% | in stock | $945.00 | $661.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE00568 |
Chemical Name: | Linoleic acid sodium salt |
CAS Number: | 822-17-3 |
Molecular Formula: | C18H31NaO2 |
Molecular Weight: | 302.4273 |
MDL Number: | MFCD00063202 |
SMILES: | CCCCCC=CCC=CCCCCCCCC(=O)[O-].[Na+] |
Complexity: | 272 |
Covalently-Bonded Unit Count: | 2 |
Defined Bond Stereocenter Count: | 2 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 2 |
Rotatable Bond Count: | 14 |
Drug metabolism and disposition: the biological fate of chemicals 20120501