AB55576
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $12.00 | $8.00 | - + | |
5g | 95% | in stock | $15.00 | $10.00 | - + | |
10g | 95% | in stock | $16.00 | $11.00 | - + | |
25g | 95% | in stock | $32.00 | $23.00 | - + | |
100g | 95% | in stock | $95.00 | $66.00 | - + | |
500g | 95% | in stock | $328.00 | $230.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB55576 |
Chemical Name: | Boc-D-Prolinol |
CAS Number: | 83435-58-9 |
Molecular Formula: | C10H19NO3 |
Molecular Weight: | 201.2628 |
MDL Number: | MFCD00040580 |
SMILES: | OC[C@H]1CCCN1C(=O)OC(C)(C)C |
Complexity: | 210 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 1 |
Bioorganic & medicinal chemistry 20121015
Cytometry. Part A : the journal of the International Society for Analytical Cytology 20060501