AB45961
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | in stock | $10.00 | $7.00 | - + | ||
25g | in stock | $34.00 | $24.00 | - + | ||
100g | in stock | $64.00 | $45.00 | - + | ||
500g | in stock | $78.00 | $55.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB45961 |
Chemical Name: | Diphenyl phosphate |
CAS Number: | 838-85-7 |
Molecular Formula: | C12H11O4P |
Molecular Weight: | 250.1871 |
MDL Number: | MFCD00003033 |
SMILES: | OP(=O)(Oc1ccccc1)Oc1ccccc1 |
Complexity: | 246 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 4 |
XLogP3: | 1.4 |
Analytica chimica acta 20121020
Journal of inorganic biochemistry 20121001
Physical chemistry chemical physics : PCCP 20120614
Inorganic chemistry 20120507
Chemosphere 20120301
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences 20120101
Analytical and bioanalytical chemistry 20111001
Proceedings of the Japan Academy. Series B, Physical and biological sciences 20110610
PloS one 20110101
Angewandte Chemie (International ed. in English) 20100910
The Journal of organic chemistry 20100903
Analytical and bioanalytical chemistry 20091001
ACS applied materials & interfaces 20090501
Inorganic chemistry 20090406
Analytical chemistry 20090401
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences 20090201
Talanta 20080715
Inorganic chemistry 20080616
Chemistry (Weinheim an der Bergstrasse, Germany) 20080101
Journal of molecular recognition : JMR 20080101
Yakugaku zasshi : Journal of the Pharmaceutical Society of Japan 20071201
Journal of the American Chemical Society 20060301
Analytical chemistry 20060301
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences 20041125
Inorganic chemistry 20040809
Analytical and bioanalytical chemistry 20040101
Organic letters 20031225
Inorganic chemistry 20030922
Journal of chromatography. A 20011214
Inorganic chemistry 20010702
The Journal of organic chemistry 20010629