AD94983
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
2mg | 98% | in stock | $7.00 | $5.00 | - + | |
5mg | 98% | in stock | $9.00 | $6.00 | - + | |
10mg | 98% | in stock | $11.00 | $8.00 | - + | |
250mg | 95% | in stock | $58.00 | $41.00 | - + | |
1g | 95% | in stock | $139.00 | $97.00 | - + | |
5g | 98% | in stock | $325.00 | $228.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD94983 |
Chemical Name: | 6-(5-fluoro-2-(3,4,5-trimethoxyphenylamino)pyrimidin-4-ylamino)-2,2-dimethyl-2H-pyrido[3,2-b] |
CAS Number: | 841290-80-0 |
Molecular Formula: | C22H23FN6O5 |
Molecular Weight: | 470.4536 |
MDL Number: | MFCD09970820 |
SMILES: | COc1cc(Nc2ncc(c(n2)Nc2ccc3c(n2)NC(=O)C(O3)(C)C)F)cc(c1OC)OC |
Complexity: | 691 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 34 |
Hydrogen Bond Acceptor Count: | 11 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 7 |
XLogP3: | 3.1 |
Journal of medicinal chemistry 20140508
Journal of medicinal chemistry 20131024
Bioorganic & medicinal chemistry letters 20130801
Journal of medicinal chemistry 20121213
Journal of medicinal chemistry 20120426
Nature biotechnology 20111030
Protein science : a publication of the Protein Society 20110201
Chemistry & biology 20101124
Chemical biology & drug design 20090401
Bioorganic & medicinal chemistry letters 20090401
Birth defects research. Part A, Clinical and molecular teratology 20090201
The Journal of pharmacology and experimental therapeutics 20061201