AI56940
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 99% | in stock | $11.00 | $8.00 | - + | |
1g | 99% | in stock | $15.00 | $10.00 | - + | |
5g | 99% | in stock | $28.00 | $20.00 | - + | |
10g | 99% | in stock | $35.00 | $25.00 | - + | |
25g | 99% | in stock | $70.00 | $49.00 | - + | |
100g | 99% | in stock | $231.00 | $162.00 | - + | |
250g | 99% | in stock | $571.00 | $400.00 | - + | |
500g | 99% | in stock | $794.00 | $556.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI56940 |
Chemical Name: | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(4-hydroxyphenoxy)oxane-3,4,5-triol |
CAS Number: | 84380-01-8 |
Molecular Formula: | C12H16O7 |
Molecular Weight: | 272.25124 |
MDL Number: | MFCD09838262 |
SMILES: | OC[C@H]1O[C@H](Oc2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
Complexity: | 279 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 5 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 5 |
Rotatable Bond Count: | 3 |
XLogP3: | -0.7 |
Theriogenology 20110801
Medicinal chemistry (Shariqah (United Arab Emirates)) 20080501
Chemistry and physics of lipids 20070501
Bioorganic & medicinal chemistry 20070301
Biotechnology letters 20050401
Chemical & pharmaceutical bulletin 20030701
Chemistry and physics of lipids 20010501