AB46177
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $8.00 | $5.00 | - + | |
5g | 98% | in stock | $12.00 | $8.00 | - + | |
10g | 98% | in stock | $16.00 | $11.00 | - + | |
25g | 98% | in stock | $33.00 | $23.00 | - + | |
100g | 98% | in stock | $123.00 | $86.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB46177 |
Chemical Name: | Fmoc-Glu-OtBu |
CAS Number: | 84793-07-7 |
Molecular Formula: | C24H27NO6 |
Molecular Weight: | 425.4743 |
MDL Number: | MFCD00065648 |
SMILES: | OC(=O)CC[C@@H](C(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2c1cccc2 |
Complexity: | 635 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 31 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 10 |
XLogP3: | 3.9 |
Fmoc-L-Glutamic Acid 1-Tert-Butyl Ester, also known as tert-butyl ester protected Fmoc-L-glutamic acid, is a key reagent widely used in peptide synthesis and other organic chemistry applications. This compound serves as a versatile building block in the production of peptide and protein derivatives due to its ability to selectively protect the carboxylic group of glutamic acid. By using Fmoc-L-Glutamic Acid 1-Tert-Butyl Ester, chemists can efficiently synthesize complex peptides and mimic natural protein structures with improved stability and enhanced chemical properties. Additionally, this compound facilitates the stepwise synthesis of long peptide chains by allowing for the controlled deprotection of the glutamic acid residue at specific stages in the assembly process. In summary, Fmoc-L-Glutamic Acid 1-Tert-Butyl Ester plays a crucial role in the synthesis of bioactive peptides and pharmaceutical compounds, enabling researchers to explore the vast potential of peptide-based therapeutics and materials.
Organic letters 20010614