AB42692
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 95% | in stock | $13.00 | $9.00 | - + | |
25g | 95% | in stock | $16.00 | $11.00 | - + | |
100g | 95% | in stock | $59.00 | $41.00 | - + | |
500g | 95% | in stock | $239.00 | $167.00 | - + | |
1kg | 95% | in stock | $462.00 | $324.00 | - + | |
5kg | 95% | in stock | $2,047.00 | $1,433.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB42692 |
Chemical Name: | 2,4'-Dichlorobenzophenone |
CAS Number: | 85-29-0 |
Molecular Formula: | C13H8Cl2O |
Molecular Weight: | 251.108 |
MDL Number: | MFCD00038744 |
SMILES: | Clc1ccc(cc1)C(=O)c1ccccc1Cl |
NSC Number: | 3221 |
Complexity: | 246 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.4 |
Journal of environmental science and health. Part. B, Pesticides, food contaminants, and agricultural wastes 20080101