AI57101
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $12.00 | $8.00 | - + | |
5g | 98% | in stock | $19.00 | $13.00 | - + | |
10g | 98% | in stock | $29.00 | $20.00 | - + | |
25g | 98% | in stock | $57.00 | $40.00 | - + | |
100g | 98% | in stock | $221.00 | $155.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI57101 |
Chemical Name: | 3-Nitrosalicylic acid |
CAS Number: | 85-38-1 |
Molecular Formula: | C7H5NO5 |
Molecular Weight: | 183.1183 |
MDL Number: | MFCD00024240 |
SMILES: | OC(=O)c1cccc(c1O)[N+](=O)[O-] |
NSC Number: | 182 |
Complexity: | 223 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.4 |
2-Hydroxy-3-nitrobenzoic acid is a versatile compound commonly used in chemical synthesis as a key intermediate in the production of pharmaceuticals, dyes, and other specialty chemicals. This compound serves as a crucial building block in organic chemistry reactions, particularly in the formation of complex organic molecules. Its hydroxyl and nitro functional groups enable it to participate in various chemical transformations, making it valuable for the creation of new compounds with diverse properties and applications. In chemical synthesis, 2-Hydroxy-3-nitrobenzoic acid can be employed to introduce specific functional groups, enhance reactivity, and facilitate the synthesis of structurally intricate molecules. Its adaptable nature and ability to undergo different reactions make it an essential component in the synthesis of advanced materials and bioactive compounds.
BMC cardiovascular disorders 20060101