AH51129
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥98% | in stock | $33.00 | $23.00 | - + | |
5mg | 98%(HPLC) | in stock | $85.00 | $60.00 | - + | |
25mg | 98%(HPLC) | in stock | $254.00 | $178.00 | - + | |
100mg | 98%(HPLC) | in stock | $761.00 | $533.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH51129 |
Chemical Name: | Galaterone |
CAS Number: | 851983-85-2 |
Molecular Formula: | C26H32N2O |
Molecular Weight: | 388.5451 |
MDL Number: | MFCD16660907 |
SMILES: | O[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CC=C2n2cnc3c2cccc3)C)C1)C |
Complexity: | 743 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 6 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 5.2 |
BMC urology 20140101
Current opinion in oncology 20120501
The Journal of biological chemistry 20120203
Nature 20120202
Steroids 20111101
The Journal of steroid biochemistry and molecular biology 20110501
British journal of cancer 20100928
Nature clinical practice. Urology 20081101
Molecular cancer therapeutics 20080901
Molecular cancer therapeutics 20080801
Molecular cancer therapeutics 20080101
Journal of medicinal chemistry 20050421