logo
Home  > Chemistry  > Organic Building Blocks  > Sulfonates  > Toluene-4-sulfonic acid 2-cyclopropoxy-ethyl ester

AB53536

862728-59-4 | Toluene-4-sulfonic acid 2-cyclopropoxy-ethyl ester

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $33.00 $23.00 -   +
1g 97% in stock $40.00 $28.00 -   +
5g 97% in stock $153.00 $107.00 -   +
10g 97% in stock $265.00 $186.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB53536
Chemical Name: Toluene-4-sulfonic acid 2-cyclopropoxy-ethyl ester
CAS Number: 862728-59-4
Molecular Formula: C12H16O4S
Molecular Weight: 256.318
MDL Number: MFCD22209886
SMILES: Cc1ccc(cc1)S(=O)(=O)OCCOC1CC1

 

Computed Properties
Complexity: 321  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 17  
Hydrogen Bond Acceptor Count: 4  
Rotatable Bond Count: 6  
XLogP3: 1.9  

 

 

Upstream Synthesis Route
  • Ethanol, 2-(cyclopropyloxy)-, 1-(4-methylbenzenesulfonate) is a versatile compound commonly used in chemical synthesis as a key building block for the creation of various organic molecules. In the realm of organic chemistry, this compound serves as an important reagent that facilitates the formation of complex structures through carbon-carbon bond formation reactions. Its unique structure allows for precise manipulation in reactions, enabling the synthesis of diverse compounds with specific properties and functions. This compound is particularly valuable in the development of pharmaceuticals, agrochemicals, and advanced materials due to its ability to participate in numerous chemical transformations leading to the formation of intricate molecular architectures.
FEATURED PRODUCTS