AH85435
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $10.00 | $7.00 | - + | |
5mg | 95% | in stock | $18.00 | $12.00 | - + | |
10mg | 95% | in stock | $28.00 | $19.00 | - + | |
25mg | 95% | in stock | $59.00 | $41.00 | - + | |
50mg | 95% | in stock | $63.00 | $44.00 | - + | |
100mg | 95% | in stock | $114.00 | $80.00 | - + | |
250mg | 95% | in stock | $158.00 | $110.00 | - + | |
1g | 95% | in stock | $484.00 | $339.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH85435 |
Chemical Name: | 1-[2-(Benzyloxy)ethyl]-4-(hydroxydiphenylmethyl)-1-quinuclidinium Bromide |
CAS Number: | 869113-09-7 |
Molecular Formula: | C29H34BrNO2 |
Molecular Weight: | 508.4898 |
MDL Number: | MFCD27976798 |
SMILES: | OC(C12CC[N+](CC1)(CC2)CCOCc1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
Complexity: | 543 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 33 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 8 |
Journal of medicinal chemistry 20090423