logo
Home  > 4-Boc-(3R)-morpholinecarboxylic acid

AB55688

869681-70-9 | 4-Boc-(3R)-morpholinecarboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $8.00 $5.00 -   +
250mg 95% in stock $12.00 $8.00 -   +
1g 95% in stock $30.00 $21.00 -   +
5g 95% in stock $100.00 $70.00 -   +
100g 95% in stock $1,879.00 $1,316.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB55688
Chemical Name: 4-Boc-(3R)-morpholinecarboxylic acid
CAS Number: 869681-70-9
Molecular Formula: C10H17NO5
Molecular Weight: 231.24568000000008
MDL Number: MFCD04114909
SMILES: OC(=O)[C@H]1COCCN1C(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • $Name$ is a versatile compound that plays a crucial role in chemical synthesis processes. Primarily, it is utilized as a key building block in the production of various pharmaceutical intermediates and fine chemicals. Its unique structure and reactivity make it a valuable component in the creation of complex organic molecules. Additionally, $Name$ is frequently employed in the development of new materials and specialized chemical formulations due to its ability to undergo diverse chemical transformations. Its application in chemical synthesis showcases its significance in the advancement of chemical research and innovation.
FEATURED PRODUCTS