AC11532
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $22.00 | $16.00 | - + | |
5mg | 97% | in stock | $54.00 | $38.00 | - + | |
10mg | 97% | in stock | $80.00 | $56.00 | - + | |
25mg | 97% | in stock | $135.00 | $95.00 | - + | |
50mg | 97% | in stock | $227.00 | $159.00 | - + | |
250mg | 97% | in stock | $657.00 | $460.00 | - + | |
1g | 97% | in stock | $1,779.00 | $1,245.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC11532 |
Chemical Name: | 4-(4-Phenoxybutoxy)-7h-furo[3,2-g]chromen-7-one |
CAS Number: | 870653-45-5 |
Molecular Formula: | C21H18O5 |
Molecular Weight: | 350.3646 |
MDL Number: | MFCD11114059 |
SMILES: | O=c1ccc2c(o1)cc1c(c2OCCCCOc2ccccc2)cco1 |
Complexity: | 499 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 7 |
XLogP3: | 4.7 |
Bioorganic & medicinal chemistry letters 20121201
American journal of physiology. Endocrinology and metabolism 20110801
Bioorganic & medicinal chemistry letters 20101201
European journal of medicinal chemistry 20090501
Experimental biology and medicine (Maywood, N.J.) 20071101
Molecular pharmacology 20051101