BO14615
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 95% | in stock | $442.00 | $309.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BO14615 |
Chemical Name: | 2-Chloro-1-[3-nitro-4-(phenylmethoxy)phenyl]ethanone |
CAS Number: | 871266-45-4 |
Molecular Formula: | C15H12ClNO4 |
Molecular Weight: | 305.7131 |
SMILES: | ClCC(=O)c1ccc(c(c1)[N+](=O)[O-])OCc1ccccc1 |
2-Chloro-1-[3-nitro-4-(phenylmethoxy)phenyl]ethanone is a valuable compound in chemical synthesis due to its versatile applications. It serves as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and specialty chemicals. This compound can be used as a building block in the synthesis of biologically active molecules, facilitating the creation of novel drug candidates and research compounds. Furthermore, its unique structure allows for customization and modification, making it a crucial component in the development of new and innovative chemical entities. Through targeted reactions and transformations, 2-Chloro-1-[3-nitro-4-(phenylmethoxy)phenyl]ethanone plays a significant role in the advancement of synthetic organic chemistry.