AH85244
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $28.00 | $20.00 | - + | |
5mg | 99% | in stock | $60.00 | $42.00 | - + | |
10mg | 99% | in stock | $91.00 | $64.00 | - + | |
25mg | 99% | in stock | $154.00 | $108.00 | - + | |
50mg | 99% | in stock | $253.00 | $177.00 | - + | |
100mg | 99% | in stock | $399.00 | $280.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH85244 |
Chemical Name: | BMS-599626 Hydrochloride |
CAS Number: | 873837-23-1 |
Molecular Formula: | C27H28ClFN8O3 |
Molecular Weight: | 567.0144232 |
MDL Number: | MFCD12407406 |
SMILES: | O=C(Nc1cn2c(c1C)c(ncn2)Nc1ccc2c(c1)cnn2Cc1cccc(c1)F)OC[C@@H]1COCCN1.Cl |
Complexity: | 828 |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 40 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 8 |
Annals of oncology : official journal of the European Society for Medical Oncology 20120201
Investigational new drugs 20110801
Journal of medicinal chemistry 20091112