876345-13-0 | 2,2-Dimethyl-4-oxo-3,8,11,14,17-pentaoxa-5-azanonadecan-19-oic acid

Packsize	Purity	Availability	Price	Discounted Price
100mg	97%	in stock	$19.00	$13.00
250mg	97%	in stock	$25.00	$17.00
1g	97%	in stock	$85.00	$59.00
5g	97%	in stock	$258.00	$180.00

Description

• Catalog Number: AH97141
• Chemical Name: 2,2-Dimethyl-4-oxo-3,8,11,14,17-pentaoxa-5-azanonadecan-19-oic acid
• CAS Number: 876345-13-0
• Molecular Formula: C15H29NO8
• Molecular Weight: 351.3927
• MDL Number: MFCD30528568
• SMILES: OC(=O)COCCOCCOCCOCCNC(=O)OC(C)(C)C

Upstream Synthesis Route

5,8,11,14-Tetraoxa-2-azahexadecanedioic acid, 1-(1,1-dimethylethyl) ester, commonly known as $name$, serves as a crucial component in chemical synthesis processes. This compound plays a significant role in the creation of various advanced materials due to its unique chemical properties.In chemical synthesis, $name$ is often utilized as a key building block for the development of specialized polymers and organic compounds. Its structural characteristics enable it to participate in complex reactions, leading to the formation of intricate molecular structures. Additionally, $name$ can act as a cross-linking agent, facilitating the synthesis of novel materials with tailored properties.Furthermore, the presence of the 1-(1,1-dimethylethyl) ester group in $name$ offers protection to reactive functionalities during synthetic transformations, allowing for selective and controlled modifications. This protective group can be strategically removed at later stages of the synthesis, unveiling the desired chemical functionalities.Overall, the application of 5,8,11,14-Tetraoxa-2-azahexadecanedioic acid, 1-(1,1-dimethylethyl) ester in chemical synthesis opens up avenues for the development of innovative materials and compounds with specialized properties and functionalities.