AD86253
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $29.00 | $20.00 | - + | |
5mg | 98% | in stock | $60.00 | $42.00 | - + | |
10mg | 98% | in stock | $89.00 | $62.00 | - + | |
25mg | 98% | in stock | $130.00 | $91.00 | - + | |
50mg | 98% | in stock | $193.00 | $135.00 | - + | |
100mg | 98% | in stock | $289.00 | $202.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD86253 |
Chemical Name: | Bi-78d3 |
CAS Number: | 883065-90-5 |
Molecular Formula: | C13H9N5O5S2 |
Molecular Weight: | 379.3711 |
MDL Number: | MFCD01313575 |
SMILES: | [O-][N+](=O)c1cnc(s1)Sc1n[nH]c(=O)n1c1ccc2c(c1)OCCO2 |
Complexity: | 588 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 9 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.7 |
Bioorganic & medicinal chemistry letters 20130801
British journal of pharmacology 20120701
Bioorganic & medicinal chemistry 20100115
Journal of medicinal chemistry 20090409
European journal of biochemistry 19751215