logo
Home  > (Diphenylphosphoryl)methanol

AB99962

884-74-2 | (Diphenylphosphoryl)methanol

Packsize Purity Availability Price Discounted Price    Quantity
250mg 98% in stock $126.00 $88.00 -   +
1g 98% in stock $171.00 $120.00 -   +
5g 98% in stock $558.00 $391.00 -   +
10g 98% in stock $946.00 $662.00 -   +
25g 98% in stock $1,879.00 $1,316.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB99962
Chemical Name: (Diphenylphosphoryl)methanol
CAS Number: 884-74-2
Molecular Formula: C13H13O2P
Molecular Weight: 232.2149
MDL Number: MFCD00087496
SMILES: OCP(=O)(c1ccccc1)c1ccccc1

 

Upstream Synthesis Route
  • Diphenylphosphorylmethanol, also known as DPPM, is a versatile chemical compound that plays a crucial role in chemical synthesis. In the field of organic chemistry, DPPM is commonly used as a ligand in transition metal-catalyzed reactions. Its unique structure containing both a phosphorus and an oxygen atom allows it to coordinate with various metal ions, facilitating complex formation and enabling selective catalytic reactions.One of the key applications of Diphenylphosphorylmethanol in chemical synthesis is its use as a ligand in metal-catalyzed cross-coupling reactions such as the Suzuki-Miyaura and Heck reactions. By forming stable complexes with transition metals like palladium, DPPM helps enhance the efficiency and selectivity of these important transformations, leading to the synthesis of biologically active molecules, pharmaceuticals, and advanced materials.Moreover, Diphenylphosphorylmethanol can also serve as a chiral auxiliary in asymmetric synthesis. Its chirality can influence the stereochemistry of the reaction, allowing for the production of enantiomerically pure compounds with high optical purity. This application is particularly valuable in the pharmaceutical industry, where precise control over molecular handedness is crucial for drug efficacy and safety.Overall, the unique properties of Diphenylphosphorylmethanol make it a valuable tool in modern chemical synthesis, enabling chemists to access a wide range of functionalized molecules and asymmetric building blocks with high efficiency and precision.
FEATURED PRODUCTS