AC12330
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $201.00 | $141.00 | - + | |
5g | 98% | in stock | $572.00 | $400.00 | - + | |
10g | 98% | in stock | $945.00 | $661.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC12330 |
Chemical Name: | 2-Chloro-4-(3,5-dimethylphenyl)benzoic acid |
CAS Number: | 884323-17-5 |
Molecular Formula: | C15H13ClO2 |
Molecular Weight: | 260.7155 |
MDL Number: | MFCD09032792 |
SMILES: | Cc1cc(C)cc(c1)c1ccc(c(c1)Cl)C(=O)O |
Complexity: | 295 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.4 |
The Journal of organic chemistry 20060331