AC01874
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $15.00 | $11.00 | - + | |
1g | 98% | in stock | $39.00 | $28.00 | - + | |
5g | 98% | in stock | $134.00 | $94.00 | - + | |
25g | 98% | in stock | $643.00 | $450.00 | - + | |
100g | 98% | in stock | $2,097.00 | $1,468.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AC01874 |
Chemical Name: | 5,11-Dihydropyrido[2,3-b][1,4]benzodiazepin-6-one |
CAS Number: | 885-70-1 |
Molecular Formula: | C12H9N3O |
Molecular Weight: | 211.2194 |
MDL Number: | MFCD00190169 |
SMILES: | O=c1[nH]c2cccnc2[nH]c2c1cccc2 |
Complexity: | 281 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
XLogP3: | 1.6 |
Journal of medicinal chemistry 19910701