logo
Home  > tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate

AW33567

885102-34-1 | tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $22.00 $15.00 -   +
250mg 97% in stock $42.00 $30.00 -   +
1g 97% in stock $124.00 $87.00 -   +
5g 97% in stock $462.00 $324.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AW33567
Chemical Name: tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate
CAS Number: 885102-34-1
Molecular Formula: C10H17NO3
Molecular Weight: 199.2469
MDL Number: MFCD29918272
SMILES: O=C1CN(CC1C)C(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • The tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate is a versatile compound that finds significant application in chemical synthesis. This compound serves as a key reagent in the preparation of various organic molecules due to its unique structural properties. The presence of the tert-butyl group provides steric hindrance, making it a useful building block for the synthesis of complex molecules with specific stereochemical requirements. Additionally, the 3-methyl-4-oxopyrrolidine-1-carboxylate moiety offers reactivity that allows for efficient functional group transformations, making it a valuable tool for organic chemists conducting diverse synthetic transformations. Its role in mediating key reactions and facilitating the formation of new chemical bonds makes tert-Butyl 3-methyl-4-oxopyrrolidine-1-carboxylate a crucial component in the arsenal of synthetic chemists.
FEATURED PRODUCTS