AD85802
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 97% | in stock | $12.00 | $9.00 | - + | |
250mg | 97% | in stock | $20.00 | $14.00 | - + | |
500mg | 97% | in stock | $35.00 | $24.00 | - + | |
1g | 97% | in stock | $48.00 | $33.00 | - + | |
5g | 97% | in stock | $183.00 | $129.00 | - + | |
100g | 97% | in stock | $2,678.00 | $1,874.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD85802 |
Chemical Name: | 4,7-Diaza-spiro[2.5]octane-7-carboxylic acid tert-butyl ester |
CAS Number: | 886766-28-5 |
Molecular Formula: | C11H20N2O2 |
Molecular Weight: | 212.2887 |
MDL Number: | MFCD08685931 |
SMILES: | O=C(N1CCNC2(C1)CC2)OC(C)(C)C |
Complexity: | 266 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.8 |
In chemical synthesis, tert-Butyl 4,7-diazaspiro[2.5]octane-7-carboxylate serves as a versatile building block for the construction of complex organic molecules. This compound can be utilized as a precursor in the synthesis of various pharmaceuticals, agrochemicals, and materials. Its unique structural features make it a valuable tool in designing and synthesizing novel compounds with diverse biological activities. Furthermore, tert-Butyl 4,7-diazaspiro[2.5]octane-7-carboxylate can be specifically modified and functionalized to introduce specific chemical functionalities, enabling the tailor-made synthesis of target molecules with desired properties. Its application in chemical synthesis opens up avenues for the creation of innovative and potentially valuable compounds for various industries and research fields.