AB47907
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $10.00 | $7.00 | - + | |
5g | 98% | in stock | $32.00 | $23.00 | - + | |
10g | 98% | in stock | $45.00 | $32.00 | - + | |
25g | 98% | in stock | $99.00 | $69.00 | - + | |
100g | 98% | in stock | $392.00 | $275.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB47907 |
Chemical Name: | Tert-butyl 4-bromo-2-fluorobenzoate |
CAS Number: | 889858-12-2 |
Molecular Formula: | C11H12BrFO2 |
Molecular Weight: | 275.1142 |
MDL Number: | MFCD08703426 |
SMILES: | Brc1ccc(c(c1)F)C(=O)OC(C)(C)C |
Complexity: | 237 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.6 |
The tert-Butyl 4-bromo-2-fluorobenzoate is a versatile compound widely used in chemical synthesis. One of its key applications is as a building block in organic chemistry for the preparation of various functionalized molecules. This compound acts as an important intermediate in the synthesis of pharmaceuticals, agrochemicals, and materials.When tert-Butyl 4-bromo-2-fluorobenzoate is used in chemical synthesis, it can undergo various reactions such as nucleophilic substitution, palladium-catalyzed coupling reactions, and ester hydrolysis. These reactions enable the introduction of diverse functional groups into the molecule, allowing for the creation of complex structures with specific properties.Additionally, tert-Butyl 4-bromo-2-fluorobenzoate can be employed in the development of new methodologies for organic synthesis, serving as a key component in the design and optimization of chemical reactions. Its unique structure and reactivity make it a valuable tool for chemists seeking to construct intricate molecular architectures efficiently and selectively.