AD33896
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $24.00 | $17.00 | - + | |
25g | 98 | in stock | $35.00 | $24.00 | - + | |
100g | 98% | in stock | $106.00 | $75.00 | - + | |
500g | 98 | in stock | $173.00 | $121.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD33896 |
Chemical Name: | 4-Chloro-2-nitrotoluene |
CAS Number: | 89-59-8 |
Molecular Formula: | C7H6ClNO2 |
Molecular Weight: | 171.5810 |
MDL Number: | MFCD00007215 |
SMILES: | Clc1ccc(c(c1)[N+](=O)[O-])C |
NSC Number: | 5386 |
Complexity: | 157 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
XLogP3: | 3.1 |
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20120601
The Journal of organic chemistry 20010518