AB86729
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $35.00 | $24.00 | - + | |
5mg | 99% | in stock | $70.00 | $49.00 | - + | |
10mg | 99% | in stock | $109.00 | $76.00 | - + | |
50mg | 99% | in stock | $328.00 | $229.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB86729 |
Chemical Name: | 2-Cyclopentyl-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid |
CAS Number: | 890842-28-1 |
Molecular Formula: | C25H22N2O2 |
Molecular Weight: | 382.4543799999999 |
MDL Number: | MFCD12828779 |
SMILES: | OC(=O)c1ccc(cc1C1CCCC1)c1c[nH]c2c1cc(cn2)c1ccccc1 |
Complexity: | 569 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 29 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 4 |
XLogP3: | 6.1 |
The Journal of biological chemistry 20160902
Bioorganic & medicinal chemistry letters 20120901
The Journal of biological chemistry 20110916
Journal of medicinal chemistry 20110728
British journal of pharmacology 20101001
Bioorganic & medicinal chemistry letters 20090801
Cancer research 20080915