AB89225
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $6.00 | $4.00 | - + | |
1g | 95% | in stock | $6.00 | $5.00 | - + | |
5g | 95% | in stock | $8.00 | $6.00 | - + | |
10g | 95% | in stock | $14.00 | $10.00 | - + | |
25g | 95% | in stock | $33.00 | $24.00 | - + | |
100g | 95% | in stock | $119.00 | $84.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB89225 |
Chemical Name: | 5'-Chloro-5'-deoxyadenosine |
CAS Number: | 892-48-8 |
Molecular Formula: | C10H12ClN5O3 |
Molecular Weight: | 285.6870 |
MDL Number: | MFCD00049038 |
SMILES: | ClC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2N |
Complexity: | 338 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | -0.3 |
Bioorganic & medicinal chemistry letters 20120615
Proceedings of the National Academy of Sciences of the United States of America 20090728
Bioorganic & medicinal chemistry 20080301
Nature chemical biology 20080101