AH85462
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 99% | 1 week | $470.00 | $329.00 | - + | |
10mg | 99% | 1 week | $680.00 | $476.00 | - + | |
50mg | 99% | 1 week | $1,752.00 | $1,226.00 | - + | |
100mg | 99% | 1 week | $2,600.00 | $1,820.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH85462 |
Chemical Name: | Akt1 and Akt2-IN-1 |
CAS Number: | 893422-47-4 |
Molecular Formula: | C33H29N7O |
Molecular Weight: | 539.6297 |
MDL Number: | MFCD13184803 |
SMILES: | O=c1[nH]ccc2c1cc(c1ccccc1)c(n2)c1ccc(cc1)CN1CCC(CC1)c1[nH]nc(n1)c1ccccn1 |