AH85371
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $25.00 | $17.00 | - + | |
5mg | 98% | in stock | $59.00 | $41.00 | - + | |
10mg | 98% | in stock | $88.00 | $61.00 | - + | |
50mg | 98% | in stock | $242.00 | $169.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH85371 |
Chemical Name: | Pf-3758309 |
CAS Number: | 898044-15-0 |
Molecular Formula: | C25H30N8OS |
Molecular Weight: | 490.62370000000004 |
MDL Number: | MFCD18633226 |
SMILES: | CN(C[C@H](c1ccccc1)NC(=O)N1Cc2c(C1(C)C)[nH]nc2Nc1nc(C)nc2c1scc2)C |
Complexity: | 747 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 6 |
XLogP3: | 3.1 |
ACS medicinal chemistry letters 20150709
Journal of medicinal chemistry 20140213
Proceedings of the National Academy of Sciences of the United States of America 20100518