AI60272
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 95% | in stock | $17.00 | $12.00 | - + | |
25g | 95% | in stock | $31.00 | $22.00 | - + | |
100g | 95% | in stock | $85.00 | $60.00 | - + | |
500g | 97% | in stock | $323.00 | $226.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI60272 |
Chemical Name: | 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid |
CAS Number: | 90-20-0 |
Molecular Formula: | C10H9NO7S2 |
Molecular Weight: | 319.3110 |
MDL Number: | MFCD00035728 |
SMILES: | Nc1cc(cc2c1c(O)cc(c2)S(=O)(=O)O)S(=O)(=O)O |
NSC Number: | 190492 |
Complexity: | 561 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.2 |
Analytica chimica acta 20110919
Analytical biochemistry 20110415
Chemosphere 20110201
International journal of molecular sciences 20110101
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20100501
Environmental monitoring and assessment 20081201
Analytical and bioanalytical chemistry 20080601
Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy 20071101
Water research 20051201
Bulletin of environmental contamination and toxicology 20020901
Guang pu xue yu guang pu fen xi = Guang pu 20020801
International journal of pharmaceutics 20020320
Journal of medicinal chemistry 19930709
Journal of medicinal chemistry 19921225
AIDS (London, England) 19900801
Life sciences 19900101