AH82400
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $63.00 | $44.00 | - + | |
2mg | 97% | in stock | $112.00 | $78.00 | - + | |
5mg | 97% | in stock | $188.00 | $131.00 | - + | |
10mg | 97% | in stock | $320.00 | $224.00 | - + | |
25mg | 97% | in stock | $560.00 | $392.00 | - + | |
50mg | 97% | in stock | $700.00 | $490.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AH82400 |
Chemical Name: | Az 960 |
CAS Number: | 905586-69-8 |
Molecular Formula: | C18H16F2N6 |
Molecular Weight: | 354.35664640000005 |
MDL Number: | MFCD16621127 |
SMILES: | N#Cc1cc(F)c(nc1N[C@H](c1ccc(cc1)F)C)Nc1n[nH]c(c1)C |
Complexity: | 503 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 5 |
XLogP3: | 4.4 |
International journal of cancer 20111115
Bioorganic & medicinal chemistry letters 20110515
Molecular cancer therapeutics 20101201
The Journal of biological chemistry 20081121