AI60608
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $19.00 | $13.00 | - + | |
1g | 98% | in stock | $23.00 | $17.00 | - + | |
5g | 98% | in stock | $102.00 | $72.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI60608 |
Chemical Name: | methyl 2-methoxy-3-nitrobenzoate |
CAS Number: | 90564-26-4 |
Molecular Formula: | C9H9NO5 |
Molecular Weight: | 211.17146000000008 |
MDL Number: | MFCD11045625 |
SMILES: | COC(=O)c1cccc(c1OC)[N+](=O)[O-] |
Methyl 2-methoxy-3-nitrobenzoate is a versatile compound used in chemical synthesis for various applications. It serves as a key intermediate in the production of pharmaceuticals, agrochemicals, and fine chemicals. Its unique chemical structure allows for diverse functionalization through modification of the nitro, methoxy, and ester groups, enabling the generation of a wide array of derivatives with tailored properties.In chemical synthesis, Methyl 2-methoxy-3-nitrobenzoate can be utilized as a building block for the construction of complex molecules. Its nitro group can undergo reduction or functional group interconversion reactions, facilitating the introduction of additional functional groups or structural modifications. The methoxy group provides steric effects and electron density contributions, influencing the reactivity and selectivity of subsequent chemical transformations. Moreover, the ester functionality offers potential sites for further derivatization or coupling reactions, enhancing the compound's synthetic utility.Overall, Methyl 2-methoxy-3-nitrobenzoate plays a crucial role in the synthesis of diverse chemical compounds, offering synthetic chemists a valuable tool for the development of novel materials and biologically active molecules. Its versatility and reactivity make it an indispensable component in the repertoire of synthetic methodologies employed in modern organic chemistry.